C11H15N3S — CID 19626600
N-[(2-ethylpyrazol-3-yl)methyl]-1-thiophen-3-ylmethanamine (PubChem CID 19626600) has the molecular formula C11H15N3S and a molecular weight of 221.33 g/mol. Its IUPAC name is N-[(2-ethylpyrazol-3-yl)methyl]-1-thiophen-3-ylmethanamine.
| Compound Name | N-[(2-ethylpyrazol-3-yl)methyl]-1-thiophen-3-ylmethanamine |
|---|---|
| PubChem CID | 19626600 |
| Molecular Formula | C11H15N3S |
| Molecular Weight | 221.33 g/mol |
| Exact Mass | 221.10 |
| IUPAC Name | N-[(2-ethylpyrazol-3-yl)methyl]-1-thiophen-3-ylmethanamine |
| SMILES | CCn1nccc1CNCc1ccsc1 |
| InChI | InChI=1S/C11H15N3S/c1-2-14-11(3-5-13-14)8-12-7-10-4-6-15-9-10/h3-6,9,12H,2,7-8H2,1H3 |
| InChIKey | WXWIHZNYBLPQNH-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.33 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |