About 4-[2-(4-methyl-1,3-thiazol-5-yl)ethoxy]aniline
4-[2-(4-methyl-1,3-thiazol-5-yl)ethoxy]aniline (PubChem CID 19626869) has the molecular formula C12H14N2OS
and a molecular weight of 234.32 g/mol. Its IUPAC name is 4-[2-(4-methyl-1,3-thiazol-5-yl)ethoxy]aniline.
Molecular Properties
| Compound Name | 4-[2-(4-methyl-1,3-thiazol-5-yl)ethoxy]aniline |
| PubChem CID | 19626869 |
| Molecular Formula | C12H14N2OS |
| Molecular Weight | 234.32 g/mol |
| Exact Mass | 234.08 |
| IUPAC Name | 4-[2-(4-methyl-1,3-thiazol-5-yl)ethoxy]aniline |
| SMILES | Cc1ncsc1CCOc1ccc(N)cc1 |
| InChI | InChI=1S/C12H14N2OS/c1-9-12(16-8-14-9)6-7-15-11-4-2-10(13)3-5-11/h2-5,8H,6-7,13H2,1H3 |
| InChIKey | GEDFJMOXJAGKQH-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.32 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-[2-(4-methyl-1,3-thiazol-5-yl)ethoxy]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-(4-methyl-1,3-thiazol-5-yl)ethoxy]aniline?
The IUPAC name of 4-[2-(4-methyl-1,3-thiazol-5-yl)ethoxy]aniline (CID 19626869) is 4-[2-(4-methyl-1,3-thiazol-5-yl)ethoxy]aniline.
What is the SMILES notation for 4-[2-(4-methyl-1,3-thiazol-5-yl)ethoxy]aniline?
The canonical SMILES for 4-[2-(4-methyl-1,3-thiazol-5-yl)ethoxy]aniline is Cc1ncsc1CCOc1ccc(N)cc1.
What is the InChIKey of 4-[2-(4-methyl-1,3-thiazol-5-yl)ethoxy]aniline?
The InChIKey is GEDFJMOXJAGKQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N2OS/c1-9-12(16-8-14-9)6-7-15-11-4-2-10(13)3-5-11/h2-5,8H,6-7,13H2,1H3.
What are the key properties of 4-[2-(4-methyl-1,3-thiazol-5-yl)ethoxy]aniline?
4-[2-(4-methyl-1,3-thiazol-5-yl)ethoxy]aniline has a molecular weight of 234.32 g/mol, XLogP of 2.66, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-(4-methyl-1,3-thiazol-5-yl)ethoxy]aniline is sourced from PubChem (CID 19626869), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).