C16H18FN5 — CID 19627697
1-(1-ethylpyrazol-3-yl)-N-[[3-(4-fluorophenyl)-1H-pyrazol-5-yl]methyl]methanamine (PubChem CID 19627697) has the molecular formula C16H18FN5 and a molecular weight of 299.35 g/mol. Its IUPAC name is 1-(1-ethylpyrazol-3-yl)-N-[[3-(4-fluorophenyl)-1H-pyrazol-5-yl]methyl]methanamine.
| Compound Name | 1-(1-ethylpyrazol-3-yl)-N-[[3-(4-fluorophenyl)-1H-pyrazol-5-yl]methyl]methanamine |
|---|---|
| PubChem CID | 19627697 |
| Molecular Formula | C16H18FN5 |
| Molecular Weight | 299.35 g/mol |
| Exact Mass | 299.15 |
| IUPAC Name | 1-(1-ethylpyrazol-3-yl)-N-[[3-(4-fluorophenyl)-1H-pyrazol-5-yl]methyl]methanamine |
| SMILES | CCn1ccc(CNCc2cc(-c3ccc(F)cc3)n[nH]2)n1 |
| InChI | InChI=1S/C16H18FN5/c1-2-22-8-7-14(21-22)10-18-11-15-9-16(20-19-15)12-3-5-13(17)6-4-12/h3-9,18H,2,10-11H2,1H3,(H,19,20) |
| InChIKey | BNQZKYQNYXXBRM-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.35 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |