C16H18FN5 — CID 19627701
N-[(1-ethylpyrazol-4-yl)methyl]-1-[3-(4-fluorophenyl)-1H-pyrazol-5-yl]methanamine (PubChem CID 19627701) has the molecular formula C16H18FN5 and a molecular weight of 299.35 g/mol. Its IUPAC name is N-[(1-ethylpyrazol-4-yl)methyl]-1-[3-(4-fluorophenyl)-1H-pyrazol-5-yl]methanamine.
| Compound Name | N-[(1-ethylpyrazol-4-yl)methyl]-1-[3-(4-fluorophenyl)-1H-pyrazol-5-yl]methanamine |
|---|---|
| PubChem CID | 19627701 |
| Molecular Formula | C16H18FN5 |
| Molecular Weight | 299.35 g/mol |
| Exact Mass | 299.15 |
| IUPAC Name | N-[(1-ethylpyrazol-4-yl)methyl]-1-[3-(4-fluorophenyl)-1H-pyrazol-5-yl]methanamine |
| SMILES | CCn1cc(CNCc2cc(-c3ccc(F)cc3)n[nH]2)cn1 |
| InChI | InChI=1S/C16H18FN5/c1-2-22-11-12(9-19-22)8-18-10-15-7-16(21-20-15)13-3-5-14(17)6-4-13/h3-7,9,11,18H,2,8,10H2,1H3,(H,20,21) |
| InChIKey | VBJRICLTRKJYRJ-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.35 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |