About N-(3-fluorophenyl)-5,5-dimethyl-4H-1,3-thiazol-2-amine
N-(3-fluorophenyl)-5,5-dimethyl-4H-1,3-thiazol-2-amine (PubChem CID 19627887) has the molecular formula C11H13FN2S
and a molecular weight of 224.30 g/mol. Its IUPAC name is N-(3-fluorophenyl)-5,5-dimethyl-4H-1,3-thiazol-2-amine.
Molecular Properties
| Compound Name | N-(3-fluorophenyl)-5,5-dimethyl-4H-1,3-thiazol-2-amine |
| PubChem CID | 19627887 |
| Molecular Formula | C11H13FN2S |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.08 |
| IUPAC Name | N-(3-fluorophenyl)-5,5-dimethyl-4H-1,3-thiazol-2-amine |
| SMILES | CC1(C)CN=C(Nc2cccc(F)c2)S1 |
| InChI | InChI=1S/C11H13FN2S/c1-11(2)7-13-10(15-11)14-9-5-3-4-8(12)6-9/h3-6H,7H2,1-2H3,(H,13,14) |
| InChIKey | BLJIAEICHZJFHF-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(3-fluorophenyl)-5,5-dimethyl-4H-1,3-thiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-fluorophenyl)-5,5-dimethyl-4H-1,3-thiazol-2-amine?
The IUPAC name of N-(3-fluorophenyl)-5,5-dimethyl-4H-1,3-thiazol-2-amine (CID 19627887) is N-(3-fluorophenyl)-5,5-dimethyl-4H-1,3-thiazol-2-amine.
What is the SMILES notation for N-(3-fluorophenyl)-5,5-dimethyl-4H-1,3-thiazol-2-amine?
The canonical SMILES for N-(3-fluorophenyl)-5,5-dimethyl-4H-1,3-thiazol-2-amine is CC1(C)CN=C(Nc2cccc(F)c2)S1.
What is the InChIKey of N-(3-fluorophenyl)-5,5-dimethyl-4H-1,3-thiazol-2-amine?
The InChIKey is BLJIAEICHZJFHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13FN2S/c1-11(2)7-13-10(15-11)14-9-5-3-4-8(12)6-9/h3-6H,7H2,1-2H3,(H,13,14).
What are the key properties of N-(3-fluorophenyl)-5,5-dimethyl-4H-1,3-thiazol-2-amine?
N-(3-fluorophenyl)-5,5-dimethyl-4H-1,3-thiazol-2-amine has a molecular weight of 224.30 g/mol, XLogP of 3.12, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-fluorophenyl)-5,5-dimethyl-4H-1,3-thiazol-2-amine is sourced from PubChem (CID 19627887), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).