C20H25NO5 — CID 19628748
N-[3-(2-ethoxyethoxy)phenyl]-2-(2-methoxyphenoxy)propanamide (PubChem CID 19628748) has the molecular formula C20H25NO5 and a molecular weight of 359.42 g/mol. Its IUPAC name is N-[3-(2-ethoxyethoxy)phenyl]-2-(2-methoxyphenoxy)propanamide.
| Compound Name | N-[3-(2-ethoxyethoxy)phenyl]-2-(2-methoxyphenoxy)propanamide |
|---|---|
| PubChem CID | 19628748 |
| Molecular Formula | C20H25NO5 |
| Molecular Weight | 359.42 g/mol |
| Exact Mass | 359.17 |
| IUPAC Name | N-[3-(2-ethoxyethoxy)phenyl]-2-(2-methoxyphenoxy)propanamide |
| SMILES | CCOCCOc1cccc(NC(=O)C(C)Oc2ccccc2OC)c1 |
| InChI | InChI=1S/C20H25NO5/c1-4-24-12-13-25-17-9-7-8-16(14-17)21-20(22)15(2)26-19-11-6-5-10-18(19)23-3/h5-11,14-15H,4,12-13H2,1-3H3,(H,21,22) |
| InChIKey | VFDSYWWTTWMMSH-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.42 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|