C22H18FNO2S — CID 19629433
4-fluoro-N-[4-[2-(4-methylphenyl)-2-oxoethyl]sulfanylphenyl]benzamide (PubChem CID 19629433) has the molecular formula C22H18FNO2S and a molecular weight of 379.46 g/mol. Its IUPAC name is 4-fluoro-N-[4-[2-(4-methylphenyl)-2-oxoethyl]sulfanylphenyl]benzamide.
| Compound Name | 4-fluoro-N-[4-[2-(4-methylphenyl)-2-oxoethyl]sulfanylphenyl]benzamide |
|---|---|
| PubChem CID | 19629433 |
| Molecular Formula | C22H18FNO2S |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.10 |
| IUPAC Name | 4-fluoro-N-[4-[2-(4-methylphenyl)-2-oxoethyl]sulfanylphenyl]benzamide |
| SMILES | Cc1ccc(C(=O)CSc2ccc(NC(=O)c3ccc(F)cc3)cc2)cc1 |
| InChI | InChI=1S/C22H18FNO2S/c1-15-2-4-16(5-3-15)21(25)14-27-20-12-10-19(11-13-20)24-22(26)17-6-8-18(23)9-7-17/h2-13H,14H2,1H3,(H,24,26) |
| InChIKey | ZAZWYVWSXSHBGU-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |