C17H16BrFN2OS — CID 19630501
2-[(2-bromophenyl)methylsulfanyl]-N-[1-(4-fluorophenyl)ethylideneamino]acetamide (PubChem CID 19630501) has the molecular formula C17H16BrFN2OS and a molecular weight of 395.30 g/mol. Its IUPAC name is 2-[(2-bromophenyl)methylsulfanyl]-N-[1-(4-fluorophenyl)ethylideneamino]acetamide.
| Compound Name | 2-[(2-bromophenyl)methylsulfanyl]-N-[1-(4-fluorophenyl)ethylideneamino]acetamide |
|---|---|
| PubChem CID | 19630501 |
| Molecular Formula | C17H16BrFN2OS |
| Molecular Weight | 395.30 g/mol |
| Exact Mass | 394.02 |
| IUPAC Name | 2-[(2-bromophenyl)methylsulfanyl]-N-[1-(4-fluorophenyl)ethylideneamino]acetamide |
| SMILES | CC(=NNC(=O)CSCc1ccccc1Br)c1ccc(F)cc1 |
| InChI | InChI=1S/C17H16BrFN2OS/c1-12(13-6-8-15(19)9-7-13)20-21-17(22)11-23-10-14-4-2-3-5-16(14)18/h2-9H,10-11H2,1H3,(H,21,22) |
| InChIKey | VWYIFHWRLFQTLX-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.30 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|