About N-bis(4-methylphenoxy)phosphoryl-2,4,6-trimethylaniline
N-bis(4-methylphenoxy)phosphoryl-2,4,6-trimethylaniline (PubChem CID 19630519) has the molecular formula C23H26NO3P
and a molecular weight of 395.44 g/mol. Its IUPAC name is N-bis(4-methylphenoxy)phosphoryl-2,4,6-trimethylaniline.
Molecular Properties
| Compound Name | N-bis(4-methylphenoxy)phosphoryl-2,4,6-trimethylaniline |
| PubChem CID | 19630519 |
| Molecular Formula | C23H26NO3P |
| Molecular Weight | 395.44 g/mol |
| Exact Mass | 395.17 |
| IUPAC Name | N-bis(4-methylphenoxy)phosphoryl-2,4,6-trimethylaniline |
| SMILES | Cc1ccc(OP(=O)(Nc2c(C)cc(C)cc2C)Oc2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C23H26NO3P/c1-16-6-10-21(11-7-16)26-28(25,27-22-12-8-17(2)9-13-22)24-23-19(4)14-18(3)15-20(23)5/h6-15H,1-5H3,(H,24,25) |
| InChIKey | KLXOVXOYJXCQRA-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 395.44 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze N-bis(4-methylphenoxy)phosphoryl-2,4,6-trimethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-bis(4-methylphenoxy)phosphoryl-2,4,6-trimethylaniline?
The IUPAC name of N-bis(4-methylphenoxy)phosphoryl-2,4,6-trimethylaniline (CID 19630519) is N-bis(4-methylphenoxy)phosphoryl-2,4,6-trimethylaniline.
What is the SMILES notation for N-bis(4-methylphenoxy)phosphoryl-2,4,6-trimethylaniline?
The canonical SMILES for N-bis(4-methylphenoxy)phosphoryl-2,4,6-trimethylaniline is Cc1ccc(OP(=O)(Nc2c(C)cc(C)cc2C)Oc2ccc(C)cc2)cc1.
What is the InChIKey of N-bis(4-methylphenoxy)phosphoryl-2,4,6-trimethylaniline?
The InChIKey is KLXOVXOYJXCQRA-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H26NO3P/c1-16-6-10-21(11-7-16)26-28(25,27-22-12-8-17(2)9-13-22)24-23-19(4)14-18(3)15-20(23)5/h6-15H,1-5H3,(H,24,25).
What are the key properties of N-bis(4-methylphenoxy)phosphoryl-2,4,6-trimethylaniline?
N-bis(4-methylphenoxy)phosphoryl-2,4,6-trimethylaniline has a molecular weight of 395.44 g/mol, XLogP of 6.91, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-bis(4-methylphenoxy)phosphoryl-2,4,6-trimethylaniline is sourced from PubChem (CID 19630519), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).