C24H22N2O4 — CID 19631126
(E)-3-(furan-2-yl)-N-[2-(morpholine-4-carbonyl)phenyl]-2-phenylprop-2-enamide (PubChem CID 19631126) has the molecular formula C24H22N2O4 and a molecular weight of 402.45 g/mol. Its IUPAC name is (E)-3-(furan-2-yl)-N-[2-(morpholine-4-carbonyl)phenyl]-2-phenylprop-2-enamide.
| Compound Name | (E)-3-(furan-2-yl)-N-[2-(morpholine-4-carbonyl)phenyl]-2-phenylprop-2-enamide |
|---|---|
| PubChem CID | 19631126 |
| Molecular Formula | C24H22N2O4 |
| Molecular Weight | 402.45 g/mol |
| Exact Mass | 402.16 |
| IUPAC Name | (E)-3-(furan-2-yl)-N-[2-(morpholine-4-carbonyl)phenyl]-2-phenylprop-2-enamide |
| SMILES | O=C(Nc1ccccc1C(=O)N1CCOCC1)/C(=C/c1ccco1)c1ccccc1 |
| InChI | InChI=1S/C24H22N2O4/c27-23(21(17-19-9-6-14-30-19)18-7-2-1-3-8-18)25-22-11-5-4-10-20(22)24(28)26-12-15-29-16-13-26/h1-11,14,17H,12-13,15-16H2,(H,25,27)/b21-17+ |
| InChIKey | NKEQVORSLYJKEJ-HEHNFIMWSA-N |
| XLogP | 3.93 |
| TPSA | 71.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.45 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|