C24H26ClN5O4S — CID 19632885
2-[[5-[(4-tert-butylphenoxy)methyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(4-chloro-3-nitrophenyl)acetamide (PubChem CID 19632885) has the molecular formula C24H26ClN5O4S and a molecular weight of 516.02 g/mol. Its IUPAC name is 2-[[5-[(4-tert-butylphenoxy)methyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(4-chloro-3-nitrophenyl)acetamide.
| Compound Name | 2-[[5-[(4-tert-butylphenoxy)methyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(4-chloro-3-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 19632885 |
| Molecular Formula | C24H26ClN5O4S |
| Molecular Weight | 516.02 g/mol |
| Exact Mass | 515.14 |
| IUPAC Name | 2-[[5-[(4-tert-butylphenoxy)methyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(4-chloro-3-nitrophenyl)acetamide |
| SMILES | C=CCn1c(COc2ccc(C(C)(C)C)cc2)nnc1SCC(=O)Nc1ccc(Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C24H26ClN5O4S/c1-5-12-29-21(14-34-18-9-6-16(7-10-18)24(2,3)4)27-28-23(29)35-15-22(31)26-17-8-11-19(25)20(13-17)30(32)33/h5-11,13H,1,12,14-15H2,2-4H3,(H,26,31) |
| InChIKey | IWZCXQUAZWPSCN-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 112.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.02 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|