C23H21Cl2N5O2S2 — CID 19632929
2-[[5-[(2,4-dichlorophenoxy)methyl]-4-methyl-1,2,4-triazol-3-yl]sulfanyl]-N-[4-(3,4-dimethylphenyl)-1,3-thiazol-2-yl]acetamide (PubChem CID 19632929) has the molecular formula C23H21Cl2N5O2S2 and a molecular weight of 534.49 g/mol. Its IUPAC name is 2-[[5-[(2,4-dichlorophenoxy)methyl]-4-methyl-1,2,4-triazol-3-yl]sulfanyl]-N-[4-(3,4-dimethylphenyl)-1,3-thiazol-2-yl]acetamide.
| Compound Name | 2-[[5-[(2,4-dichlorophenoxy)methyl]-4-methyl-1,2,4-triazol-3-yl]sulfanyl]-N-[4-(3,4-dimethylphenyl)-1,3-thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 19632929 |
| Molecular Formula | C23H21Cl2N5O2S2 |
| Molecular Weight | 534.49 g/mol |
| Exact Mass | 533.05 |
| IUPAC Name | 2-[[5-[(2,4-dichlorophenoxy)methyl]-4-methyl-1,2,4-triazol-3-yl]sulfanyl]-N-[4-(3,4-dimethylphenyl)-1,3-thiazol-2-yl]acetamide |
| SMILES | Cc1ccc(-c2csc(NC(=O)CSc3nnc(COc4ccc(Cl)cc4Cl)n3C)n2)cc1C |
| InChI | InChI=1S/C23H21Cl2N5O2S2/c1-13-4-5-15(8-14(13)2)18-11-33-22(26-18)27-21(31)12-34-23-29-28-20(30(23)3)10-32-19-7-6-16(24)9-17(19)25/h4-9,11H,10,12H2,1-3H3,(H,26,27,31) |
| InChIKey | FGDNHVADWXININ-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.49 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |