C19H22Cl2N4O2S — CID 19633257
N-cyclopentyl-2-[[5-[(2,4-dichlorophenoxy)methyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetamide (PubChem CID 19633257) has the molecular formula C19H22Cl2N4O2S and a molecular weight of 441.38 g/mol. Its IUPAC name is N-cyclopentyl-2-[[5-[(2,4-dichlorophenoxy)methyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetamide.
| Compound Name | N-cyclopentyl-2-[[5-[(2,4-dichlorophenoxy)methyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 19633257 |
| Molecular Formula | C19H22Cl2N4O2S |
| Molecular Weight | 441.38 g/mol |
| Exact Mass | 440.08 |
| IUPAC Name | N-cyclopentyl-2-[[5-[(2,4-dichlorophenoxy)methyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetamide |
| SMILES | C=CCn1c(COc2ccc(Cl)cc2Cl)nnc1SCC(=O)NC1CCCC1 |
| InChI | InChI=1S/C19H22Cl2N4O2S/c1-2-9-25-17(11-27-16-8-7-13(20)10-15(16)21)23-24-19(25)28-12-18(26)22-14-5-3-4-6-14/h2,7-8,10,14H,1,3-6,9,11-12H2,(H,22,26) |
| InChIKey | NLZVNCUYPLTZGK-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.38 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|