C22H25N3O2S — CID 19635986
3-[(3-methoxyphenyl)methylsulfanyl]-5-[1-(2-methylphenoxy)ethyl]-4-prop-2-enyl-1,2,4-triazole (PubChem CID 19635986) has the molecular formula C22H25N3O2S and a molecular weight of 395.53 g/mol. Its IUPAC name is 3-[(3-methoxyphenyl)methylsulfanyl]-5-[1-(2-methylphenoxy)ethyl]-4-prop-2-enyl-1,2,4-triazole.
| Compound Name | 3-[(3-methoxyphenyl)methylsulfanyl]-5-[1-(2-methylphenoxy)ethyl]-4-prop-2-enyl-1,2,4-triazole |
|---|---|
| PubChem CID | 19635986 |
| Molecular Formula | C22H25N3O2S |
| Molecular Weight | 395.53 g/mol |
| Exact Mass | 395.17 |
| IUPAC Name | 3-[(3-methoxyphenyl)methylsulfanyl]-5-[1-(2-methylphenoxy)ethyl]-4-prop-2-enyl-1,2,4-triazole |
| SMILES | C=CCn1c(SCc2cccc(OC)c2)nnc1C(C)Oc1ccccc1C |
| InChI | InChI=1S/C22H25N3O2S/c1-5-13-25-21(17(3)27-20-12-7-6-9-16(20)2)23-24-22(25)28-15-18-10-8-11-19(14-18)26-4/h5-12,14,17H,1,13,15H2,2-4H3 |
| InChIKey | GWZYFOOLHMGWSA-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 49.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.53 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|