C19H25N3O3S — CID 19637464
ethyl 2-[[5-[1-(3,5-dimethylphenoxy)ethyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetate (PubChem CID 19637464) has the molecular formula C19H25N3O3S and a molecular weight of 375.49 g/mol. Its IUPAC name is ethyl 2-[[5-[1-(3,5-dimethylphenoxy)ethyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetate.
| Compound Name | ethyl 2-[[5-[1-(3,5-dimethylphenoxy)ethyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetate |
|---|---|
| PubChem CID | 19637464 |
| Molecular Formula | C19H25N3O3S |
| Molecular Weight | 375.49 g/mol |
| Exact Mass | 375.16 |
| IUPAC Name | ethyl 2-[[5-[1-(3,5-dimethylphenoxy)ethyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetate |
| SMILES | C=CCn1c(SCC(=O)OCC)nnc1C(C)Oc1cc(C)cc(C)c1 |
| InChI | InChI=1S/C19H25N3O3S/c1-6-8-22-18(20-21-19(22)26-12-17(23)24-7-2)15(5)25-16-10-13(3)9-14(4)11-16/h6,9-11,15H,1,7-8,12H2,2-5H3 |
| InChIKey | NNXJEYKMNZATQS-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 66.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.49 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|