C26H25Cl2N5O2S2 — CID 19637725
N-[4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl]-2-[[5-[1-(2,3-dimethylphenoxy)ethyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetamide (PubChem CID 19637725) has the molecular formula C26H25Cl2N5O2S2 and a molecular weight of 574.56 g/mol. Its IUPAC name is N-[4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl]-2-[[5-[1-(2,3-dimethylphenoxy)ethyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetamide.
| Compound Name | N-[4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl]-2-[[5-[1-(2,3-dimethylphenoxy)ethyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 19637725 |
| Molecular Formula | C26H25Cl2N5O2S2 |
| Molecular Weight | 574.56 g/mol |
| Exact Mass | 573.08 |
| IUPAC Name | N-[4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl]-2-[[5-[1-(2,3-dimethylphenoxy)ethyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetamide |
| SMILES | C=CCn1c(SCC(=O)Nc2nc(-c3ccc(Cl)cc3Cl)cs2)nnc1C(C)Oc1cccc(C)c1C |
| InChI | InChI=1S/C26H25Cl2N5O2S2/c1-5-11-33-24(17(4)35-22-8-6-7-15(2)16(22)3)31-32-26(33)37-14-23(34)30-25-29-21(13-36-25)19-10-9-18(27)12-20(19)28/h5-10,12-13,17H,1,11,14H2,2-4H3,(H,29,30,34) |
| InChIKey | ZSSRPEBAIFPWKQ-UHFFFAOYSA-N |
| XLogP | 7.38 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.56 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|