C21H19Cl3N4O2S — CID 19638441
N-(3-chlorophenyl)-2-[[5-[1-(2,5-dichlorophenoxy)ethyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetamide (PubChem CID 19638441) has the molecular formula C21H19Cl3N4O2S and a molecular weight of 497.84 g/mol. Its IUPAC name is N-(3-chlorophenyl)-2-[[5-[1-(2,5-dichlorophenoxy)ethyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetamide.
| Compound Name | N-(3-chlorophenyl)-2-[[5-[1-(2,5-dichlorophenoxy)ethyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 19638441 |
| Molecular Formula | C21H19Cl3N4O2S |
| Molecular Weight | 497.84 g/mol |
| Exact Mass | 496.03 |
| IUPAC Name | N-(3-chlorophenyl)-2-[[5-[1-(2,5-dichlorophenoxy)ethyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetamide |
| SMILES | C=CCn1c(SCC(=O)Nc2cccc(Cl)c2)nnc1C(C)Oc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C21H19Cl3N4O2S/c1-3-9-28-20(13(2)30-18-11-15(23)7-8-17(18)24)26-27-21(28)31-12-19(29)25-16-6-4-5-14(22)10-16/h3-8,10-11,13H,1,9,12H2,2H3,(H,25,29) |
| InChIKey | VUELEBMFCQDCLA-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.84 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|