C22H23Cl3N4O2S — CID 19639049
2-[[4-ethyl-5-[1-(4-ethylphenoxy)ethyl]-1,2,4-triazol-3-yl]sulfanyl]-N-(2,4,5-trichlorophenyl)acetamide (PubChem CID 19639049) has the molecular formula C22H23Cl3N4O2S and a molecular weight of 513.88 g/mol. Its IUPAC name is 2-[[4-ethyl-5-[1-(4-ethylphenoxy)ethyl]-1,2,4-triazol-3-yl]sulfanyl]-N-(2,4,5-trichlorophenyl)acetamide.
| Compound Name | 2-[[4-ethyl-5-[1-(4-ethylphenoxy)ethyl]-1,2,4-triazol-3-yl]sulfanyl]-N-(2,4,5-trichlorophenyl)acetamide |
|---|---|
| PubChem CID | 19639049 |
| Molecular Formula | C22H23Cl3N4O2S |
| Molecular Weight | 513.88 g/mol |
| Exact Mass | 512.06 |
| IUPAC Name | 2-[[4-ethyl-5-[1-(4-ethylphenoxy)ethyl]-1,2,4-triazol-3-yl]sulfanyl]-N-(2,4,5-trichlorophenyl)acetamide |
| SMILES | CCc1ccc(OC(C)c2nnc(SCC(=O)Nc3cc(Cl)c(Cl)cc3Cl)n2CC)cc1 |
| InChI | InChI=1S/C22H23Cl3N4O2S/c1-4-14-6-8-15(9-7-14)31-13(3)21-27-28-22(29(21)5-2)32-12-20(30)26-19-11-17(24)16(23)10-18(19)25/h6-11,13H,4-5,12H2,1-3H3,(H,26,30) |
| InChIKey | YTWZTSKYDQKAGM-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.88 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|