C25H23N5O3S2 — CID 19643031
2-[[5-[5-methyl-4-(4-methylphenyl)thiophen-3-yl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(3-nitrophenyl)acetamide (PubChem CID 19643031) has the molecular formula C25H23N5O3S2 and a molecular weight of 505.63 g/mol. Its IUPAC name is 2-[[5-[5-methyl-4-(4-methylphenyl)thiophen-3-yl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(3-nitrophenyl)acetamide.
| Compound Name | 2-[[5-[5-methyl-4-(4-methylphenyl)thiophen-3-yl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(3-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 19643031 |
| Molecular Formula | C25H23N5O3S2 |
| Molecular Weight | 505.63 g/mol |
| Exact Mass | 505.12 |
| IUPAC Name | 2-[[5-[5-methyl-4-(4-methylphenyl)thiophen-3-yl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(3-nitrophenyl)acetamide |
| SMILES | C=CCn1c(SCC(=O)Nc2cccc([N+](=O)[O-])c2)nnc1-c1csc(C)c1-c1ccc(C)cc1 |
| InChI | InChI=1S/C25H23N5O3S2/c1-4-12-29-24(21-14-34-17(3)23(21)18-10-8-16(2)9-11-18)27-28-25(29)35-15-22(31)26-19-6-5-7-20(13-19)30(32)33/h4-11,13-14H,1,12,15H2,2-3H3,(H,26,31) |
| InChIKey | AUDMOJBGJJPJDE-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 102.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.63 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|