C23H30N6O2S2 — CID 19643398
N-(5-cyclohexyl-1,3,4-thiadiazol-2-yl)-2-[[5-[(2,4-dimethylphenoxy)methyl]-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]acetamide (PubChem CID 19643398) has the molecular formula C23H30N6O2S2 and a molecular weight of 486.67 g/mol. Its IUPAC name is N-(5-cyclohexyl-1,3,4-thiadiazol-2-yl)-2-[[5-[(2,4-dimethylphenoxy)methyl]-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]acetamide.
| Compound Name | N-(5-cyclohexyl-1,3,4-thiadiazol-2-yl)-2-[[5-[(2,4-dimethylphenoxy)methyl]-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 19643398 |
| Molecular Formula | C23H30N6O2S2 |
| Molecular Weight | 486.67 g/mol |
| Exact Mass | 486.19 |
| IUPAC Name | N-(5-cyclohexyl-1,3,4-thiadiazol-2-yl)-2-[[5-[(2,4-dimethylphenoxy)methyl]-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]acetamide |
| SMILES | CCn1c(COc2ccc(C)cc2C)nnc1SCC(=O)Nc1nnc(C2CCCCC2)s1 |
| InChI | InChI=1S/C23H30N6O2S2/c1-4-29-19(13-31-18-11-10-15(2)12-16(18)3)25-28-23(29)32-14-20(30)24-22-27-26-21(33-22)17-8-6-5-7-9-17/h10-12,17H,4-9,13-14H2,1-3H3,(H,24,27,30) |
| InChIKey | QDYBBZUUBFOLBF-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 94.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.67 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |