C22H24ClN3OS — CID 19643809
3-[(2-chlorophenyl)methylsulfanyl]-5-[1-(2,4-dimethylphenoxy)ethyl]-4-prop-2-enyl-1,2,4-triazole (PubChem CID 19643809) has the molecular formula C22H24ClN3OS and a molecular weight of 413.97 g/mol. Its IUPAC name is 3-[(2-chlorophenyl)methylsulfanyl]-5-[1-(2,4-dimethylphenoxy)ethyl]-4-prop-2-enyl-1,2,4-triazole.
| Compound Name | 3-[(2-chlorophenyl)methylsulfanyl]-5-[1-(2,4-dimethylphenoxy)ethyl]-4-prop-2-enyl-1,2,4-triazole |
|---|---|
| PubChem CID | 19643809 |
| Molecular Formula | C22H24ClN3OS |
| Molecular Weight | 413.97 g/mol |
| Exact Mass | 413.13 |
| IUPAC Name | 3-[(2-chlorophenyl)methylsulfanyl]-5-[1-(2,4-dimethylphenoxy)ethyl]-4-prop-2-enyl-1,2,4-triazole |
| SMILES | C=CCn1c(SCc2ccccc2Cl)nnc1C(C)Oc1ccc(C)cc1C |
| InChI | InChI=1S/C22H24ClN3OS/c1-5-12-26-21(17(4)27-20-11-10-15(2)13-16(20)3)24-25-22(26)28-14-18-8-6-7-9-19(18)23/h5-11,13,17H,1,12,14H2,2-4H3 |
| InChIKey | QTOUNBIKFSTJSD-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.97 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|