C22H17Cl2NO3 — CID 19645145
4-chloro-N-[4-[1-(3-chlorophenyl)-1-oxopropan-2-yl]oxyphenyl]benzamide (PubChem CID 19645145) has the molecular formula C22H17Cl2NO3 and a molecular weight of 414.29 g/mol. Its IUPAC name is 4-chloro-N-[4-[1-(3-chlorophenyl)-1-oxopropan-2-yl]oxyphenyl]benzamide.
| Compound Name | 4-chloro-N-[4-[1-(3-chlorophenyl)-1-oxopropan-2-yl]oxyphenyl]benzamide |
|---|---|
| PubChem CID | 19645145 |
| Molecular Formula | C22H17Cl2NO3 |
| Molecular Weight | 414.29 g/mol |
| Exact Mass | 413.06 |
| IUPAC Name | 4-chloro-N-[4-[1-(3-chlorophenyl)-1-oxopropan-2-yl]oxyphenyl]benzamide |
| SMILES | CC(Oc1ccc(NC(=O)c2ccc(Cl)cc2)cc1)C(=O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C22H17Cl2NO3/c1-14(21(26)16-3-2-4-18(24)13-16)28-20-11-9-19(10-12-20)25-22(27)15-5-7-17(23)8-6-15/h2-14H,1H3,(H,25,27) |
| InChIKey | YMZUPCXXJDNXCV-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.29 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |