C19H20N2O5 — CID 19645279
N-[3-(3,3-dimethyl-2-oxobutoxy)phenyl]-3-nitrobenzamide (PubChem CID 19645279) has the molecular formula C19H20N2O5 and a molecular weight of 356.38 g/mol. Its IUPAC name is N-[3-(3,3-dimethyl-2-oxobutoxy)phenyl]-3-nitrobenzamide.
| Compound Name | N-[3-(3,3-dimethyl-2-oxobutoxy)phenyl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 19645279 |
| Molecular Formula | C19H20N2O5 |
| Molecular Weight | 356.38 g/mol |
| Exact Mass | 356.14 |
| IUPAC Name | N-[3-(3,3-dimethyl-2-oxobutoxy)phenyl]-3-nitrobenzamide |
| SMILES | CC(C)(C)C(=O)COc1cccc(NC(=O)c2cccc([N+](=O)[O-])c2)c1 |
| InChI | InChI=1S/C19H20N2O5/c1-19(2,3)17(22)12-26-16-9-5-7-14(11-16)20-18(23)13-6-4-8-15(10-13)21(24)25/h4-11H,12H2,1-3H3,(H,20,23) |
| InChIKey | CLIJXHSLSULCBV-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.38 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|