C39H30Br2N2O9 — CID 19645792
[4-[2-[2-(1,8-dibromo-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-17-yl)-4-methylpentanoyl]oxyacetyl]phenyl] 4-nitrobenzoate (PubChem CID 19645792) has the molecular formula C39H30Br2N2O9 and a molecular weight of 830.48 g/mol. Its IUPAC name is [4-[2-[2-(1,8-dibromo-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-17-yl)-4-methylpentanoyl]oxyacetyl]phenyl] 4-nitrobenzoate.
| Compound Name | [4-[2-[2-(1,8-dibromo-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-17-yl)-4-methylpentanoyl]oxyacetyl]phenyl] 4-nitrobenzoate |
|---|---|
| PubChem CID | 19645792 |
| Molecular Formula | C39H30Br2N2O9 |
| Molecular Weight | 830.48 g/mol |
| Exact Mass | 828.03 |
| IUPAC Name | [4-[2-[2-(1,8-dibromo-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-17-yl)-4-methylpentanoyl]oxyacetyl]phenyl] 4-nitrobenzoate |
| SMILES | CC(C)CC(C(=O)OCC(=O)c1ccc(OC(=O)c2ccc([N+](=O)[O-])cc2)cc1)N1C(=O)C2C(C1=O)C1(Br)c3ccccc3C2(Br)c2ccccc21 |
| InChI | InChI=1S/C39H30Br2N2O9/c1-21(2)19-30(37(48)51-20-31(44)22-13-17-25(18-14-22)52-36(47)23-11-15-24(16-12-23)43(49)50)42-34(45)32-33(35(42)46)39(41)27-8-4-3-7-26(27)38(32,40)28-9-5-6-10-29(28)39/h3-18,21,30,32-33H,19-20H2,1-2H3 |
| InChIKey | JEHOAXRLASIHHJ-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 150.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 830.48 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|