About (1-oxo-1-phenylbutan-2-yl) 6-bromo-3,8-dimethyl-2-phenylquinoline-4-carboxylate
(1-oxo-1-phenylbutan-2-yl) 6-bromo-3,8-dimethyl-2-phenylquinoline-4-carboxylate (PubChem CID 19646281) has the molecular formula C28H24BrNO3
and a molecular weight of 502.41 g/mol. Its IUPAC name is (1-oxo-1-phenylbutan-2-yl) 6-bromo-3,8-dimethyl-2-phenylquinoline-4-carboxylate.
Molecular Properties
| Compound Name | (1-oxo-1-phenylbutan-2-yl) 6-bromo-3,8-dimethyl-2-phenylquinoline-4-carboxylate |
| PubChem CID | 19646281 |
| Molecular Formula | C28H24BrNO3 |
| Molecular Weight | 502.41 g/mol |
| Exact Mass | 501.09 |
| IUPAC Name | (1-oxo-1-phenylbutan-2-yl) 6-bromo-3,8-dimethyl-2-phenylquinoline-4-carboxylate |
| SMILES | CCC(OC(=O)c1c(C)c(-c2ccccc2)nc2c(C)cc(Br)cc12)C(=O)c1ccccc1 |
| InChI | InChI=1S/C28H24BrNO3/c1-4-23(27(31)20-13-9-6-10-14-20)33-28(32)24-18(3)26(19-11-7-5-8-12-19)30-25-17(2)15-21(29)16-22(24)25/h5-16,23H,4H2,1-3H3 |
| InChIKey | STQAITVANMLCQJ-UHFFFAOYSA-N |
| XLogP | 7.10 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 502.41 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (1-oxo-1-phenylbutan-2-yl) 6-bromo-3,8-dimethyl-2-phenylquinoline-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-oxo-1-phenylbutan-2-yl) 6-bromo-3,8-dimethyl-2-phenylquinoline-4-carboxylate?
The IUPAC name of (1-oxo-1-phenylbutan-2-yl) 6-bromo-3,8-dimethyl-2-phenylquinoline-4-carboxylate (CID 19646281) is (1-oxo-1-phenylbutan-2-yl) 6-bromo-3,8-dimethyl-2-phenylquinoline-4-carboxylate.
What is the SMILES notation for (1-oxo-1-phenylbutan-2-yl) 6-bromo-3,8-dimethyl-2-phenylquinoline-4-carboxylate?
The canonical SMILES for (1-oxo-1-phenylbutan-2-yl) 6-bromo-3,8-dimethyl-2-phenylquinoline-4-carboxylate is CCC(OC(=O)c1c(C)c(-c2ccccc2)nc2c(C)cc(Br)cc12)C(=O)c1ccccc1.
What is the InChIKey of (1-oxo-1-phenylbutan-2-yl) 6-bromo-3,8-dimethyl-2-phenylquinoline-4-carboxylate?
The InChIKey is STQAITVANMLCQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H24BrNO3/c1-4-23(27(31)20-13-9-6-10-14-20)33-28(32)24-18(3)26(19-11-7-5-8-12-19)30-25-17(2)15-21(29)16-22(24)25/h5-16,23H,4H2,1-3H3.
What are the key properties of (1-oxo-1-phenylbutan-2-yl) 6-bromo-3,8-dimethyl-2-phenylquinoline-4-carboxylate?
(1-oxo-1-phenylbutan-2-yl) 6-bromo-3,8-dimethyl-2-phenylquinoline-4-carboxylate has a molecular weight of 502.41 g/mol, XLogP of 7.10, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (1-oxo-1-phenylbutan-2-yl) 6-bromo-3,8-dimethyl-2-phenylquinoline-4-carboxylate is sourced from PubChem (CID 19646281), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).