C26H23ClN2O4 — CID 19646297
N-(4-chlorophenyl)-N-[(3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl)methyl]-2-methoxybenzamide (PubChem CID 19646297) has the molecular formula C26H23ClN2O4 and a molecular weight of 462.93 g/mol. Its IUPAC name is N-(4-chlorophenyl)-N-[(3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl)methyl]-2-methoxybenzamide.
| Compound Name | N-(4-chlorophenyl)-N-[(3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl)methyl]-2-methoxybenzamide |
|---|---|
| PubChem CID | 19646297 |
| Molecular Formula | C26H23ClN2O4 |
| Molecular Weight | 462.93 g/mol |
| Exact Mass | 462.13 |
| IUPAC Name | N-(4-chlorophenyl)-N-[(3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl)methyl]-2-methoxybenzamide |
| SMILES | COc1ccccc1C(=O)N(CN1C(=O)C2C3C=CC(C4CC34)C2C1=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C26H23ClN2O4/c1-33-21-5-3-2-4-18(21)24(30)28(15-8-6-14(27)7-9-15)13-29-25(31)22-16-10-11-17(20-12-19(16)20)23(22)26(29)32/h2-11,16-17,19-20,22-23H,12-13H2,1H3 |
| InChIKey | CBWMWILNQNVWCO-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.93 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|