C30H31BrN2O3 — CID 19646604
N-(4-bromo-2,6-diethylphenyl)-N-[(3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl)methyl]-2-methylbenzamide (PubChem CID 19646604) has the molecular formula C30H31BrN2O3 and a molecular weight of 547.49 g/mol. Its IUPAC name is N-(4-bromo-2,6-diethylphenyl)-N-[(3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl)methyl]-2-methylbenzamide.
| Compound Name | N-(4-bromo-2,6-diethylphenyl)-N-[(3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl)methyl]-2-methylbenzamide |
|---|---|
| PubChem CID | 19646604 |
| Molecular Formula | C30H31BrN2O3 |
| Molecular Weight | 547.49 g/mol |
| Exact Mass | 546.15 |
| IUPAC Name | N-(4-bromo-2,6-diethylphenyl)-N-[(3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl)methyl]-2-methylbenzamide |
| SMILES | CCc1cc(Br)cc(CC)c1N(CN1C(=O)C2C3C=CC(C4CC34)C2C1=O)C(=O)c1ccccc1C |
| InChI | InChI=1S/C30H31BrN2O3/c1-4-17-12-19(31)13-18(5-2)27(17)32(28(34)20-9-7-6-8-16(20)3)15-33-29(35)25-21-10-11-22(24-14-23(21)24)26(25)30(33)36/h6-13,21-26H,4-5,14-15H2,1-3H3 |
| InChIKey | GRYPPXXYPOTFTE-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.49 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|