C25H20BrClN2O2 — CID 19646659
6-bromo-N-(5-chloro-2-methoxyphenyl)-8-methyl-2-(4-methylphenyl)quinoline-4-carboxamide (PubChem CID 19646659) has the molecular formula C25H20BrClN2O2 and a molecular weight of 495.80 g/mol. Its IUPAC name is 6-bromo-N-(5-chloro-2-methoxyphenyl)-8-methyl-2-(4-methylphenyl)quinoline-4-carboxamide.
| Compound Name | 6-bromo-N-(5-chloro-2-methoxyphenyl)-8-methyl-2-(4-methylphenyl)quinoline-4-carboxamide |
|---|---|
| PubChem CID | 19646659 |
| Molecular Formula | C25H20BrClN2O2 |
| Molecular Weight | 495.80 g/mol |
| Exact Mass | 494.04 |
| IUPAC Name | 6-bromo-N-(5-chloro-2-methoxyphenyl)-8-methyl-2-(4-methylphenyl)quinoline-4-carboxamide |
| SMILES | COc1ccc(Cl)cc1NC(=O)c1cc(-c2ccc(C)cc2)nc2c(C)cc(Br)cc12 |
| InChI | InChI=1S/C25H20BrClN2O2/c1-14-4-6-16(7-5-14)21-13-20(19-11-17(26)10-15(2)24(19)28-21)25(30)29-22-12-18(27)8-9-23(22)31-3/h4-13H,1-3H3,(H,29,30) |
| InChIKey | PJFGLLRWBDUWDC-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.80 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |