C25H24N2O3S2 — CID 19648855
methyl 2-[(2-benzoylphenyl)carbamothioylamino]-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 19648855) has the molecular formula C25H24N2O3S2 and a molecular weight of 464.61 g/mol. Its IUPAC name is methyl 2-[(2-benzoylphenyl)carbamothioylamino]-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | methyl 2-[(2-benzoylphenyl)carbamothioylamino]-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 19648855 |
| Molecular Formula | C25H24N2O3S2 |
| Molecular Weight | 464.61 g/mol |
| Exact Mass | 464.12 |
| IUPAC Name | methyl 2-[(2-benzoylphenyl)carbamothioylamino]-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | COC(=O)c1c(NC(=S)Nc2ccccc2C(=O)c2ccccc2)sc2c1CCC(C)C2 |
| InChI | InChI=1S/C25H24N2O3S2/c1-15-12-13-18-20(14-15)32-23(21(18)24(29)30-2)27-25(31)26-19-11-7-6-10-17(19)22(28)16-8-4-3-5-9-16/h3-11,15H,12-14H2,1-2H3,(H2,26,27,31) |
| InChIKey | CHFRNKWHYPPONC-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.61 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|