About 1-butyl-3-heptylthiourea
1-butyl-3-heptylthiourea (PubChem CID 19650868) has the molecular formula C12H26N2S
and a molecular weight of 230.42 g/mol. Its IUPAC name is 1-butyl-3-heptylthiourea.
Molecular Properties
| Compound Name | 1-butyl-3-heptylthiourea |
| PubChem CID | 19650868 |
| Molecular Formula | C12H26N2S |
| Molecular Weight | 230.42 g/mol |
| Exact Mass | 230.18 |
| IUPAC Name | 1-butyl-3-heptylthiourea |
| SMILES | CCCCCCCNC(=S)NCCCC |
| InChI | InChI=1S/C12H26N2S/c1-3-5-7-8-9-11-14-12(15)13-10-6-4-2/h3-11H2,1-2H3,(H2,13,14,15) |
| InChIKey | CDYVXIDDLVEANT-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.42 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-butyl-3-heptylthiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butyl-3-heptylthiourea?
The IUPAC name of 1-butyl-3-heptylthiourea (CID 19650868) is 1-butyl-3-heptylthiourea.
What is the SMILES notation for 1-butyl-3-heptylthiourea?
The canonical SMILES for 1-butyl-3-heptylthiourea is CCCCCCCNC(=S)NCCCC.
What is the InChIKey of 1-butyl-3-heptylthiourea?
The InChIKey is CDYVXIDDLVEANT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H26N2S/c1-3-5-7-8-9-11-14-12(15)13-10-6-4-2/h3-11H2,1-2H3,(H2,13,14,15).
What are the key properties of 1-butyl-3-heptylthiourea?
1-butyl-3-heptylthiourea has a molecular weight of 230.42 g/mol, XLogP of 3.22, 9 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butyl-3-heptylthiourea is sourced from PubChem (CID 19650868), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).