C21H34N2O2S2 — CID 19651075
ethyl 2-(octylcarbamothioylamino)-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-3-carboxylate (PubChem CID 19651075) has the molecular formula C21H34N2O2S2 and a molecular weight of 410.65 g/mol. Its IUPAC name is ethyl 2-(octylcarbamothioylamino)-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-3-carboxylate.
| Compound Name | ethyl 2-(octylcarbamothioylamino)-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 19651075 |
| Molecular Formula | C21H34N2O2S2 |
| Molecular Weight | 410.65 g/mol |
| Exact Mass | 410.21 |
| IUPAC Name | ethyl 2-(octylcarbamothioylamino)-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-3-carboxylate |
| SMILES | CCCCCCCCNC(=S)Nc1sc2c(c1C(=O)OCC)CCCCC2 |
| InChI | InChI=1S/C21H34N2O2S2/c1-3-5-6-7-8-12-15-22-21(26)23-19-18(20(24)25-4-2)16-13-10-9-11-14-17(16)27-19/h3-15H2,1-2H3,(H2,22,23,26) |
| InChIKey | GCXVSIZEVVPMKZ-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.65 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|