C12H24N2S — CID 19651771
1-(2-ethylhexyl)-3-prop-2-enylthiourea (PubChem CID 19651771) has the molecular formula C12H24N2S and a molecular weight of 228.40 g/mol. Its IUPAC name is 1-(2-ethylhexyl)-3-prop-2-enylthiourea.
| Compound Name | 1-(2-ethylhexyl)-3-prop-2-enylthiourea |
|---|---|
| PubChem CID | 19651771 |
| Molecular Formula | C12H24N2S |
| Molecular Weight | 228.40 g/mol |
| Exact Mass | 228.17 |
| IUPAC Name | 1-(2-ethylhexyl)-3-prop-2-enylthiourea |
| SMILES | C=CCNC(=S)NCC(CC)CCCC |
| InChI | InChI=1S/C12H24N2S/c1-4-7-8-11(6-3)10-14-12(15)13-9-5-2/h5,11H,2,4,6-10H2,1,3H3,(H2,13,14,15) |
| InChIKey | FQOAXRPQWJOPJI-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.40 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|