About 3-butyl-1,1-bis(prop-2-enyl)thiourea
3-butyl-1,1-bis(prop-2-enyl)thiourea (PubChem CID 19653088) has the molecular formula C11H20N2S
and a molecular weight of 212.36 g/mol. Its IUPAC name is 3-butyl-1,1-bis(prop-2-enyl)thiourea.
Molecular Properties
| Compound Name | 3-butyl-1,1-bis(prop-2-enyl)thiourea |
| PubChem CID | 19653088 |
| Molecular Formula | C11H20N2S |
| Molecular Weight | 212.36 g/mol |
| Exact Mass | 212.13 |
| IUPAC Name | 3-butyl-1,1-bis(prop-2-enyl)thiourea |
| SMILES | C=CCN(CC=C)C(=S)NCCCC |
| InChI | InChI=1S/C11H20N2S/c1-4-7-8-12-11(14)13(9-5-2)10-6-3/h5-6H,2-4,7-10H2,1H3,(H,12,14) |
| InChIKey | XDQAWYLZRDTCRZ-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.36 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 3-butyl-1,1-bis(prop-2-enyl)thiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-butyl-1,1-bis(prop-2-enyl)thiourea?
The IUPAC name of 3-butyl-1,1-bis(prop-2-enyl)thiourea (CID 19653088) is 3-butyl-1,1-bis(prop-2-enyl)thiourea.
What is the SMILES notation for 3-butyl-1,1-bis(prop-2-enyl)thiourea?
The canonical SMILES for 3-butyl-1,1-bis(prop-2-enyl)thiourea is C=CCN(CC=C)C(=S)NCCCC.
What is the InChIKey of 3-butyl-1,1-bis(prop-2-enyl)thiourea?
The InChIKey is XDQAWYLZRDTCRZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20N2S/c1-4-7-8-12-11(14)13(9-5-2)10-6-3/h5-6H,2-4,7-10H2,1H3,(H,12,14).
What are the key properties of 3-butyl-1,1-bis(prop-2-enyl)thiourea?
3-butyl-1,1-bis(prop-2-enyl)thiourea has a molecular weight of 212.36 g/mol, XLogP of 2.34, 7 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-butyl-1,1-bis(prop-2-enyl)thiourea is sourced from PubChem (CID 19653088), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).