About 3-butyl-1,1-bis(2-methylpropyl)thiourea
3-butyl-1,1-bis(2-methylpropyl)thiourea (PubChem CID 19653240) has the molecular formula C13H28N2S
and a molecular weight of 244.45 g/mol. Its IUPAC name is 3-butyl-1,1-bis(2-methylpropyl)thiourea.
Molecular Properties
| Compound Name | 3-butyl-1,1-bis(2-methylpropyl)thiourea |
| PubChem CID | 19653240 |
| Molecular Formula | C13H28N2S |
| Molecular Weight | 244.45 g/mol |
| Exact Mass | 244.20 |
| IUPAC Name | 3-butyl-1,1-bis(2-methylpropyl)thiourea |
| SMILES | CCCCNC(=S)N(CC(C)C)CC(C)C |
| InChI | InChI=1S/C13H28N2S/c1-6-7-8-14-13(16)15(9-11(2)3)10-12(4)5/h11-12H,6-10H2,1-5H3,(H,14,16) |
| InChIKey | LYSAOOJZRKQCIW-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.45 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 3-butyl-1,1-bis(2-methylpropyl)thiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-butyl-1,1-bis(2-methylpropyl)thiourea?
The IUPAC name of 3-butyl-1,1-bis(2-methylpropyl)thiourea (CID 19653240) is 3-butyl-1,1-bis(2-methylpropyl)thiourea.
What is the SMILES notation for 3-butyl-1,1-bis(2-methylpropyl)thiourea?
The canonical SMILES for 3-butyl-1,1-bis(2-methylpropyl)thiourea is CCCCNC(=S)N(CC(C)C)CC(C)C.
What is the InChIKey of 3-butyl-1,1-bis(2-methylpropyl)thiourea?
The InChIKey is LYSAOOJZRKQCIW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H28N2S/c1-6-7-8-14-13(16)15(9-11(2)3)10-12(4)5/h11-12H,6-10H2,1-5H3,(H,14,16).
What are the key properties of 3-butyl-1,1-bis(2-methylpropyl)thiourea?
3-butyl-1,1-bis(2-methylpropyl)thiourea has a molecular weight of 244.45 g/mol, XLogP of 3.28, 7 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-butyl-1,1-bis(2-methylpropyl)thiourea is sourced from PubChem (CID 19653240), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).