C22H31BrN2O2 — CID 19655
diethyl-[2-[(2-hydroxy-2,2-diphenylacetyl)-methylamino]ethyl]-methylazanium bromide (PubChem CID 19655) has the molecular formula C22H31BrN2O2 and a molecular weight of 435.41 g/mol. Its IUPAC name is diethyl-[2-[(2-hydroxy-2,2-diphenylacetyl)-methylamino]ethyl]-methylazanium bromide.
| Compound Name | diethyl-[2-[(2-hydroxy-2,2-diphenylacetyl)-methylamino]ethyl]-methylazanium bromide |
|---|---|
| PubChem CID | 19655 |
| Molecular Formula | C22H31BrN2O2 |
| Molecular Weight | 435.41 g/mol |
| Exact Mass | 434.16 |
| IUPAC Name | diethyl-[2-[(2-hydroxy-2,2-diphenylacetyl)-methylamino]ethyl]-methylazanium bromide |
| SMILES | CC[N+](C)(CC)CCN(C)C(=O)C(O)(c1ccccc1)c1ccccc1.[Br-] |
| InChI | InChI=1S/C22H31N2O2.BrH/c1-5-24(4,6-2)18-17-23(3)21(25)22(26,19-13-9-7-10-14-19)20-15-11-8-12-16-20;/h7-16,26H,5-6,17-18H2,1-4H3;1H/q+1;/p-1 |
| InChIKey | HJPSPFGEZNBKDT-UHFFFAOYSA-M |
| XLogP | -0.13 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.41 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|