C20H16N2O — CID 19656626
4-(3-methylphenyl)-6-(4-methylphenyl)-2-oxo-1H-pyridine-3-carbonitrile (PubChem CID 19656626) has the molecular formula C20H16N2O and a molecular weight of 300.36 g/mol. Its IUPAC name is 4-(3-methylphenyl)-6-(4-methylphenyl)-2-oxo-1H-pyridine-3-carbonitrile.
| Compound Name | 4-(3-methylphenyl)-6-(4-methylphenyl)-2-oxo-1H-pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 19656626 |
| Molecular Formula | C20H16N2O |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.13 |
| IUPAC Name | 4-(3-methylphenyl)-6-(4-methylphenyl)-2-oxo-1H-pyridine-3-carbonitrile |
| SMILES | Cc1ccc(-c2cc(-c3cccc(C)c3)c(C#N)c(=O)[nH]2)cc1 |
| InChI | InChI=1S/C20H16N2O/c1-13-6-8-15(9-7-13)19-11-17(18(12-21)20(23)22-19)16-5-3-4-14(2)10-16/h3-11H,1-2H3,(H,22,23) |
| InChIKey | FTNXQWHLGLOHCU-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 56.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |