C17H8F4N2OS — CID 19657053
4-[2-fluoro-5-(trifluoromethyl)phenyl]-2-oxo-6-thiophen-2-yl-1H-pyridine-3-carbonitrile (PubChem CID 19657053) has the molecular formula C17H8F4N2OS and a molecular weight of 364.32 g/mol. Its IUPAC name is 4-[2-fluoro-5-(trifluoromethyl)phenyl]-2-oxo-6-thiophen-2-yl-1H-pyridine-3-carbonitrile.
| Compound Name | 4-[2-fluoro-5-(trifluoromethyl)phenyl]-2-oxo-6-thiophen-2-yl-1H-pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 19657053 |
| Molecular Formula | C17H8F4N2OS |
| Molecular Weight | 364.32 g/mol |
| Exact Mass | 364.03 |
| IUPAC Name | 4-[2-fluoro-5-(trifluoromethyl)phenyl]-2-oxo-6-thiophen-2-yl-1H-pyridine-3-carbonitrile |
| SMILES | N#Cc1c(-c2cc(C(F)(F)F)ccc2F)cc(-c2cccs2)[nH]c1=O |
| InChI | InChI=1S/C17H8F4N2OS/c18-13-4-3-9(17(19,20)21)6-11(13)10-7-14(15-2-1-5-25-15)23-16(24)12(10)8-22/h1-7H,(H,23,24) |
| InChIKey | SGYMZXADTBLJHA-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 56.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.32 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |