C22H17BrN2O4 — CID 19657799
N-[(E)-(6-bromo-1,3-benzodioxol-5-yl)methylideneamino]-2-phenylmethoxybenzamide (PubChem CID 19657799) has the molecular formula C22H17BrN2O4 and a molecular weight of 453.29 g/mol. Its IUPAC name is N-[(E)-(6-bromo-1,3-benzodioxol-5-yl)methylideneamino]-2-phenylmethoxybenzamide.
| Compound Name | N-[(E)-(6-bromo-1,3-benzodioxol-5-yl)methylideneamino]-2-phenylmethoxybenzamide |
|---|---|
| PubChem CID | 19657799 |
| Molecular Formula | C22H17BrN2O4 |
| Molecular Weight | 453.29 g/mol |
| Exact Mass | 452.04 |
| IUPAC Name | N-[(E)-(6-bromo-1,3-benzodioxol-5-yl)methylideneamino]-2-phenylmethoxybenzamide |
| SMILES | O=C(N/N=C/c1cc2c(cc1Br)OCO2)c1ccccc1OCc1ccccc1 |
| InChI | InChI=1S/C22H17BrN2O4/c23-18-11-21-20(28-14-29-21)10-16(18)12-24-25-22(26)17-8-4-5-9-19(17)27-13-15-6-2-1-3-7-15/h1-12H,13-14H2,(H,25,26)/b24-12+ |
| InChIKey | IXDPDTSRIOREIU-WYMPLXKRSA-N |
| XLogP | 4.52 |
| TPSA | 69.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.29 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|