C13H11N5O4 — CID 19658032
3-(3-methoxyphenyl)-5-[(4-nitropyrazol-1-yl)methyl]-1,2,4-oxadiazole (PubChem CID 19658032) has the molecular formula C13H11N5O4 and a molecular weight of 301.26 g/mol. Its IUPAC name is 3-(3-methoxyphenyl)-5-[(4-nitropyrazol-1-yl)methyl]-1,2,4-oxadiazole.
| Compound Name | 3-(3-methoxyphenyl)-5-[(4-nitropyrazol-1-yl)methyl]-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 19658032 |
| Molecular Formula | C13H11N5O4 |
| Molecular Weight | 301.26 g/mol |
| Exact Mass | 301.08 |
| IUPAC Name | 3-(3-methoxyphenyl)-5-[(4-nitropyrazol-1-yl)methyl]-1,2,4-oxadiazole |
| SMILES | COc1cccc(-c2noc(Cn3cc([N+](=O)[O-])cn3)n2)c1 |
| InChI | InChI=1S/C13H11N5O4/c1-21-11-4-2-3-9(5-11)13-15-12(22-16-13)8-17-7-10(6-14-17)18(19)20/h2-7H,8H2,1H3 |
| InChIKey | WQAUGSOCTWTOJJ-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 109.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.26 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|