C23H17BrFN3O5 — CID 19658888
[2-[(E)-[[2-(4-bromo-2-fluoroanilino)-2-oxoacetyl]hydrazinylidene]methyl]phenyl] 2-methoxybenzoate (PubChem CID 19658888) has the molecular formula C23H17BrFN3O5 and a molecular weight of 514.31 g/mol. Its IUPAC name is [2-[(E)-[[2-(4-bromo-2-fluoroanilino)-2-oxoacetyl]hydrazinylidene]methyl]phenyl] 2-methoxybenzoate.
| Compound Name | [2-[(E)-[[2-(4-bromo-2-fluoroanilino)-2-oxoacetyl]hydrazinylidene]methyl]phenyl] 2-methoxybenzoate |
|---|---|
| PubChem CID | 19658888 |
| Molecular Formula | C23H17BrFN3O5 |
| Molecular Weight | 514.31 g/mol |
| Exact Mass | 513.03 |
| IUPAC Name | [2-[(E)-[[2-(4-bromo-2-fluoroanilino)-2-oxoacetyl]hydrazinylidene]methyl]phenyl] 2-methoxybenzoate |
| SMILES | COc1ccccc1C(=O)Oc1ccccc1/C=N/NC(=O)C(=O)Nc1ccc(Br)cc1F |
| InChI | InChI=1S/C23H17BrFN3O5/c1-32-20-9-5-3-7-16(20)23(31)33-19-8-4-2-6-14(19)13-26-28-22(30)21(29)27-18-11-10-15(24)12-17(18)25/h2-13H,1H3,(H,27,29)(H,28,30)/b26-13+ |
| InChIKey | BTMHAJGTSMNFPX-LGJNPRDNSA-N |
| XLogP | 3.90 |
| TPSA | 106.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.31 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|