C23H18N4O3 — CID 19660375
N-(4-cyanophenyl)-N'-[(E)-(3-phenylmethoxyphenyl)methylideneamino]oxamide (PubChem CID 19660375) has the molecular formula C23H18N4O3 and a molecular weight of 398.42 g/mol. Its IUPAC name is N-(4-cyanophenyl)-N'-[(E)-(3-phenylmethoxyphenyl)methylideneamino]oxamide.
| Compound Name | N-(4-cyanophenyl)-N'-[(E)-(3-phenylmethoxyphenyl)methylideneamino]oxamide |
|---|---|
| PubChem CID | 19660375 |
| Molecular Formula | C23H18N4O3 |
| Molecular Weight | 398.42 g/mol |
| Exact Mass | 398.14 |
| IUPAC Name | N-(4-cyanophenyl)-N'-[(E)-(3-phenylmethoxyphenyl)methylideneamino]oxamide |
| SMILES | N#Cc1ccc(NC(=O)C(=O)N/N=C/c2cccc(OCc3ccccc3)c2)cc1 |
| InChI | InChI=1S/C23H18N4O3/c24-14-17-9-11-20(12-10-17)26-22(28)23(29)27-25-15-19-7-4-8-21(13-19)30-16-18-5-2-1-3-6-18/h1-13,15H,16H2,(H,26,28)(H,27,29)/b25-15+ |
| InChIKey | UHUBJBOZOKMRLJ-MFKUBSTISA-N |
| XLogP | 3.23 |
| TPSA | 103.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.42 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|