C15H25Cl2N3O — CID 19661853
N-(4-methylphenyl)-3-(4-methylpiperazin-1-yl)propanamide;dihydrochloride (PubChem CID 19661853) has the molecular formula C15H25Cl2N3O and a molecular weight of 334.29 g/mol. Its IUPAC name is N-(4-methylphenyl)-3-(4-methylpiperazin-1-yl)propanamide;dihydrochloride.
| Compound Name | N-(4-methylphenyl)-3-(4-methylpiperazin-1-yl)propanamide;dihydrochloride |
|---|---|
| PubChem CID | 19661853 |
| Molecular Formula | C15H25Cl2N3O |
| Molecular Weight | 334.29 g/mol |
| Exact Mass | 333.14 |
| IUPAC Name | N-(4-methylphenyl)-3-(4-methylpiperazin-1-yl)propanamide;dihydrochloride |
| SMILES | Cc1ccc(NC(=O)CCN2CCN(C)CC2)cc1.Cl.Cl |
| InChI | InChI=1S/C15H23N3O.2ClH/c1-13-3-5-14(6-4-13)16-15(19)7-8-18-11-9-17(2)10-12-18;;/h3-6H,7-12H2,1-2H3,(H,16,19);2*1H |
| InChIKey | VVJGZXDQCDQFAK-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.29 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |