C17H15N7 — CID 19662003
N-[(E)-1-(4-aminophenyl)ethylideneamino]-[1,2,4]triazolo[3,4-a]phthalazin-6-amine (PubChem CID 19662003) has the molecular formula C17H15N7 and a molecular weight of 317.36 g/mol. Its IUPAC name is N-[(E)-1-(4-aminophenyl)ethylideneamino]-[1,2,4]triazolo[3,4-a]phthalazin-6-amine.
| Compound Name | N-[(E)-1-(4-aminophenyl)ethylideneamino]-[1,2,4]triazolo[3,4-a]phthalazin-6-amine |
|---|---|
| PubChem CID | 19662003 |
| Molecular Formula | C17H15N7 |
| Molecular Weight | 317.36 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | N-[(E)-1-(4-aminophenyl)ethylideneamino]-[1,2,4]triazolo[3,4-a]phthalazin-6-amine |
| SMILES | C/C(=N\Nc1nn2cnnc2c2ccccc12)c1ccc(N)cc1 |
| InChI | InChI=1S/C17H15N7/c1-11(12-6-8-13(18)9-7-12)20-21-16-14-4-2-3-5-15(14)17-22-19-10-24(17)23-16/h2-10H,18H2,1H3,(H,21,23)/b20-11+ |
| InChIKey | BVUBKBQWYFWVPG-RGVLZGJSSA-N |
| XLogP | 2.70 |
| TPSA | 93.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.36 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_anil(14)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|