C25H20INO4 — CID 19663654
(4Z)-4-[[3-iodo-5-methoxy-4-[(2-methylphenyl)methoxy]phenyl]methylidene]-2-phenyl-1,3-oxazol-5-one (PubChem CID 19663654) has the molecular formula C25H20INO4 and a molecular weight of 525.34 g/mol. Its IUPAC name is (4Z)-4-[[3-iodo-5-methoxy-4-[(2-methylphenyl)methoxy]phenyl]methylidene]-2-phenyl-1,3-oxazol-5-one.
| Compound Name | (4Z)-4-[[3-iodo-5-methoxy-4-[(2-methylphenyl)methoxy]phenyl]methylidene]-2-phenyl-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 19663654 |
| Molecular Formula | C25H20INO4 |
| Molecular Weight | 525.34 g/mol |
| Exact Mass | 525.04 |
| IUPAC Name | (4Z)-4-[[3-iodo-5-methoxy-4-[(2-methylphenyl)methoxy]phenyl]methylidene]-2-phenyl-1,3-oxazol-5-one |
| SMILES | COc1cc(/C=C2\N=C(c3ccccc3)OC2=O)cc(I)c1OCc1ccccc1C |
| InChI | InChI=1S/C25H20INO4/c1-16-8-6-7-11-19(16)15-30-23-20(26)12-17(14-22(23)29-2)13-21-25(28)31-24(27-21)18-9-4-3-5-10-18/h3-14H,15H2,1-2H3/b21-13- |
| InChIKey | GHMKSSNZFVVTHF-BKUYFWCQSA-N |
| XLogP | 5.53 |
| TPSA | 57.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.34 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|