C23H13Br3ClNO3 — CID 19664178
(4Z)-2-(2-chlorophenyl)-4-[[3,5-dibromo-4-[(2-bromophenyl)methoxy]phenyl]methylidene]-1,3-oxazol-5-one (PubChem CID 19664178) has the molecular formula C23H13Br3ClNO3 and a molecular weight of 626.53 g/mol. Its IUPAC name is (4Z)-2-(2-chlorophenyl)-4-[[3,5-dibromo-4-[(2-bromophenyl)methoxy]phenyl]methylidene]-1,3-oxazol-5-one.
| Compound Name | (4Z)-2-(2-chlorophenyl)-4-[[3,5-dibromo-4-[(2-bromophenyl)methoxy]phenyl]methylidene]-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 19664178 |
| Molecular Formula | C23H13Br3ClNO3 |
| Molecular Weight | 626.53 g/mol |
| Exact Mass | 622.81 |
| IUPAC Name | (4Z)-2-(2-chlorophenyl)-4-[[3,5-dibromo-4-[(2-bromophenyl)methoxy]phenyl]methylidene]-1,3-oxazol-5-one |
| SMILES | O=C1OC(c2ccccc2Cl)=N/C1=C\c1cc(Br)c(OCc2ccccc2Br)c(Br)c1 |
| InChI | InChI=1S/C23H13Br3ClNO3/c24-16-7-3-1-5-14(16)12-30-21-17(25)9-13(10-18(21)26)11-20-23(29)31-22(28-20)15-6-2-4-8-19(15)27/h1-11H,12H2/b20-11- |
| InChIKey | IFVYLBQQKJZKSZ-JAIQZWGSSA-N |
| XLogP | 7.55 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.53 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|