C24H16BrN3O8 — CID 19665080
(4Z)-4-[[3-bromo-5-methoxy-4-[(3-nitrophenyl)methoxy]phenyl]methylidene]-2-(4-nitrophenyl)-1,3-oxazol-5-one (PubChem CID 19665080) has the molecular formula C24H16BrN3O8 and a molecular weight of 554.31 g/mol. Its IUPAC name is (4Z)-4-[[3-bromo-5-methoxy-4-[(3-nitrophenyl)methoxy]phenyl]methylidene]-2-(4-nitrophenyl)-1,3-oxazol-5-one.
| Compound Name | (4Z)-4-[[3-bromo-5-methoxy-4-[(3-nitrophenyl)methoxy]phenyl]methylidene]-2-(4-nitrophenyl)-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 19665080 |
| Molecular Formula | C24H16BrN3O8 |
| Molecular Weight | 554.31 g/mol |
| Exact Mass | 553.01 |
| IUPAC Name | (4Z)-4-[[3-bromo-5-methoxy-4-[(3-nitrophenyl)methoxy]phenyl]methylidene]-2-(4-nitrophenyl)-1,3-oxazol-5-one |
| SMILES | COc1cc(/C=C2\N=C(c3ccc([N+](=O)[O-])cc3)OC2=O)cc(Br)c1OCc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C24H16BrN3O8/c1-34-21-12-15(10-19(25)22(21)35-13-14-3-2-4-18(9-14)28(32)33)11-20-24(29)36-23(26-20)16-5-7-17(8-6-16)27(30)31/h2-12H,13H2,1H3/b20-11- |
| InChIKey | GHPQOMFWIUIAPS-JAIQZWGSSA-N |
| XLogP | 5.20 |
| TPSA | 143.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.31 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|