C22H13ClN2O4 — CID 19665294
(4Z)-4-[(4-chloro-3-nitrophenyl)methylidene]-2-(4-phenylphenyl)-1,3-oxazol-5-one (PubChem CID 19665294) has the molecular formula C22H13ClN2O4 and a molecular weight of 404.81 g/mol. Its IUPAC name is (4Z)-4-[(4-chloro-3-nitrophenyl)methylidene]-2-(4-phenylphenyl)-1,3-oxazol-5-one.
| Compound Name | (4Z)-4-[(4-chloro-3-nitrophenyl)methylidene]-2-(4-phenylphenyl)-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 19665294 |
| Molecular Formula | C22H13ClN2O4 |
| Molecular Weight | 404.81 g/mol |
| Exact Mass | 404.06 |
| IUPAC Name | (4Z)-4-[(4-chloro-3-nitrophenyl)methylidene]-2-(4-phenylphenyl)-1,3-oxazol-5-one |
| SMILES | O=C1OC(c2ccc(-c3ccccc3)cc2)=N/C1=C\c1ccc(Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C22H13ClN2O4/c23-18-11-6-14(13-20(18)25(27)28)12-19-22(26)29-21(24-19)17-9-7-16(8-10-17)15-4-2-1-3-5-15/h1-13H/b19-12- |
| InChIKey | HBRONYLUGCDLDN-UNOMPAQXSA-N |
| XLogP | 5.26 |
| TPSA | 81.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.81 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|