C26H20BrFN2O6 — CID 19666890
(4Z)-4-[[3-bromo-5-ethoxy-4-[(3-fluorophenyl)methoxy]phenyl]methylidene]-2-(2-methyl-3-nitrophenyl)-1,3-oxazol-5-one (PubChem CID 19666890) has the molecular formula C26H20BrFN2O6 and a molecular weight of 555.36 g/mol. Its IUPAC name is (4Z)-4-[[3-bromo-5-ethoxy-4-[(3-fluorophenyl)methoxy]phenyl]methylidene]-2-(2-methyl-3-nitrophenyl)-1,3-oxazol-5-one.
| Compound Name | (4Z)-4-[[3-bromo-5-ethoxy-4-[(3-fluorophenyl)methoxy]phenyl]methylidene]-2-(2-methyl-3-nitrophenyl)-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 19666890 |
| Molecular Formula | C26H20BrFN2O6 |
| Molecular Weight | 555.36 g/mol |
| Exact Mass | 554.05 |
| IUPAC Name | (4Z)-4-[[3-bromo-5-ethoxy-4-[(3-fluorophenyl)methoxy]phenyl]methylidene]-2-(2-methyl-3-nitrophenyl)-1,3-oxazol-5-one |
| SMILES | CCOc1cc(/C=C2\N=C(c3cccc([N+](=O)[O-])c3C)OC2=O)cc(Br)c1OCc1cccc(F)c1 |
| InChI | InChI=1S/C26H20BrFN2O6/c1-3-34-23-13-17(11-20(27)24(23)35-14-16-6-4-7-18(28)10-16)12-21-26(31)36-25(29-21)19-8-5-9-22(15(19)2)30(32)33/h4-13H,3,14H2,1-2H3/b21-12- |
| InChIKey | FFXREYUXDCATMM-MTJSOVHGSA-N |
| XLogP | 6.13 |
| TPSA | 100.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.36 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|