C20H14BrI2NO3 — CID 19669435
(4Z)-2-(2-bromophenyl)-4-[[3,5-diiodo-4-(2-methylprop-2-enoxy)phenyl]methylidene]-1,3-oxazol-5-one (PubChem CID 19669435) has the molecular formula C20H14BrI2NO3 and a molecular weight of 650.05 g/mol. Its IUPAC name is (4Z)-2-(2-bromophenyl)-4-[[3,5-diiodo-4-(2-methylprop-2-enoxy)phenyl]methylidene]-1,3-oxazol-5-one.
| Compound Name | (4Z)-2-(2-bromophenyl)-4-[[3,5-diiodo-4-(2-methylprop-2-enoxy)phenyl]methylidene]-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 19669435 |
| Molecular Formula | C20H14BrI2NO3 |
| Molecular Weight | 650.05 g/mol |
| Exact Mass | 648.82 |
| IUPAC Name | (4Z)-2-(2-bromophenyl)-4-[[3,5-diiodo-4-(2-methylprop-2-enoxy)phenyl]methylidene]-1,3-oxazol-5-one |
| SMILES | C=C(C)COc1c(I)cc(/C=C2\N=C(c3ccccc3Br)OC2=O)cc1I |
| InChI | InChI=1S/C20H14BrI2NO3/c1-11(2)10-26-18-15(22)7-12(8-16(18)23)9-17-20(25)27-19(24-17)13-5-3-4-6-14(13)21/h3-9H,1,10H2,2H3/b17-9- |
| InChIKey | QIFHYHSJCFKJSP-MFOYZWKCSA-N |
| XLogP | 5.96 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.05 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|