C20H18BrNO3 — CID 19669487
(4Z)-2-(2-bromophenyl)-4-[(2-butoxyphenyl)methylidene]-1,3-oxazol-5-one (PubChem CID 19669487) has the molecular formula C20H18BrNO3 and a molecular weight of 400.27 g/mol. Its IUPAC name is (4Z)-2-(2-bromophenyl)-4-[(2-butoxyphenyl)methylidene]-1,3-oxazol-5-one.
| Compound Name | (4Z)-2-(2-bromophenyl)-4-[(2-butoxyphenyl)methylidene]-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 19669487 |
| Molecular Formula | C20H18BrNO3 |
| Molecular Weight | 400.27 g/mol |
| Exact Mass | 399.05 |
| IUPAC Name | (4Z)-2-(2-bromophenyl)-4-[(2-butoxyphenyl)methylidene]-1,3-oxazol-5-one |
| SMILES | CCCCOc1ccccc1/C=C1\N=C(c2ccccc2Br)OC1=O |
| InChI | InChI=1S/C20H18BrNO3/c1-2-3-12-24-18-11-7-4-8-14(18)13-17-20(23)25-19(22-17)15-9-5-6-10-16(15)21/h4-11,13H,2-3,12H2,1H3/b17-13- |
| InChIKey | KUWVOZSCOZNAHH-LGMDPLHJSA-N |
| XLogP | 4.97 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.27 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|